About (1-carbamoylcyclohexyl) 2-[4-(aminomethyl)phenyl]-1H-imidazole-5-carboxylate
(1-carbamoylcyclohexyl) 2-[4-(aminomethyl)phenyl]-1H-imidazole-5-carboxylate (PubChem CID 174631697) has the molecular formula C18H22N4O3
and a molecular weight of 342.40 g/mol. Its IUPAC name is (1-carbamoylcyclohexyl) 2-[4-(aminomethyl)phenyl]-1H-imidazole-5-carboxylate.
Molecular Properties
| Compound Name | (1-carbamoylcyclohexyl) 2-[4-(aminomethyl)phenyl]-1H-imidazole-5-carboxylate |
| PubChem CID | 174631697 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | (1-carbamoylcyclohexyl) 2-[4-(aminomethyl)phenyl]-1H-imidazole-5-carboxylate |
| SMILES | NCc1ccc(-c2ncc(C(=O)OC3(C(N)=O)CCCCC3)[nH]2)cc1 |
| InChI | InChI=1S/C18H22N4O3/c19-10-12-4-6-13(7-5-12)15-21-11-14(22-15)16(23)25-18(17(20)24)8-2-1-3-9-18/h4-7,11H,1-3,8-10,19H2,(H2,20,24)(H,21,22) |
| InChIKey | RORWWLWLQIWCIE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-carbamoylcyclohexyl) 2-[4-(aminomethyl)phenyl]-1H-imidazole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-carbamoylcyclohexyl) 2-[4-(aminomethyl)phenyl]-1H-imidazole-5-carboxylate?
The IUPAC name of (1-carbamoylcyclohexyl) 2-[4-(aminomethyl)phenyl]-1H-imidazole-5-carboxylate (CID 174631697) is (1-carbamoylcyclohexyl) 2-[4-(aminomethyl)phenyl]-1H-imidazole-5-carboxylate.
What is the SMILES notation for (1-carbamoylcyclohexyl) 2-[4-(aminomethyl)phenyl]-1H-imidazole-5-carboxylate?
The canonical SMILES for (1-carbamoylcyclohexyl) 2-[4-(aminomethyl)phenyl]-1H-imidazole-5-carboxylate is NCc1ccc(-c2ncc(C(=O)OC3(C(N)=O)CCCCC3)[nH]2)cc1.
What is the InChIKey of (1-carbamoylcyclohexyl) 2-[4-(aminomethyl)phenyl]-1H-imidazole-5-carboxylate?
The InChIKey is RORWWLWLQIWCIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N4O3/c19-10-12-4-6-13(7-5-12)15-21-11-14(22-15)16(23)25-18(17(20)24)8-2-1-3-9-18/h4-7,11H,1-3,8-10,19H2,(H2,20,24)(H,21,22).
What are the key properties of (1-carbamoylcyclohexyl) 2-[4-(aminomethyl)phenyl]-1H-imidazole-5-carboxylate?
(1-carbamoylcyclohexyl) 2-[4-(aminomethyl)phenyl]-1H-imidazole-5-carboxylate has a molecular weight of 342.40 g/mol, XLogP of 1.88, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-carbamoylcyclohexyl) 2-[4-(aminomethyl)phenyl]-1H-imidazole-5-carboxylate is sourced from PubChem (CID 174631697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).