About phenylmethanimine;triethoxy(propyl)silane
phenylmethanimine;triethoxy(propyl)silane (PubChem CID 174631923) has the molecular formula C16H29NO3Si
and a molecular weight of 311.50 g/mol. Its IUPAC name is phenylmethanimine;triethoxy(propyl)silane.
Molecular Properties
| Compound Name | phenylmethanimine;triethoxy(propyl)silane |
| PubChem CID | 174631923 |
| Molecular Formula | C16H29NO3Si |
| Molecular Weight | 311.50 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | phenylmethanimine;triethoxy(propyl)silane |
| SMILES | CCC[Si](OCC)(OCC)OCC.[H]/N=C/c1ccccc1 |
| InChI | InChI=1S/C9H22O3Si.C7H7N/c1-5-9-13(10-6-2,11-7-3)12-8-4;8-6-7-4-2-1-3-5-7/h5-9H2,1-4H3;1-6,8H/b;8-6+ |
| InChIKey | LOAVIAIZCNEBAP-ZQGZPJDTSA-N |
| XLogP | 4.13 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.50 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze phenylmethanimine;triethoxy(propyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenylmethanimine;triethoxy(propyl)silane?
The IUPAC name of phenylmethanimine;triethoxy(propyl)silane (CID 174631923) is phenylmethanimine;triethoxy(propyl)silane.
What is the SMILES notation for phenylmethanimine;triethoxy(propyl)silane?
The canonical SMILES for phenylmethanimine;triethoxy(propyl)silane is CCC[Si](OCC)(OCC)OCC.[H]/N=C/c1ccccc1.
What is the InChIKey of phenylmethanimine;triethoxy(propyl)silane?
The InChIKey is LOAVIAIZCNEBAP-ZQGZPJDTSA-N. The full InChI is InChI=1S/C9H22O3Si.C7H7N/c1-5-9-13(10-6-2,11-7-3)12-8-4;8-6-7-4-2-1-3-5-7/h5-9H2,1-4H3;1-6,8H/b;8-6+.
What are the key properties of phenylmethanimine;triethoxy(propyl)silane?
phenylmethanimine;triethoxy(propyl)silane has a molecular weight of 311.50 g/mol, XLogP of 4.13, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenylmethanimine;triethoxy(propyl)silane is sourced from PubChem (CID 174631923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).