C14H17FN2O5S — CID 17463231
3-[2-(4-fluorophenoxy)ethyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione (PubChem CID 17463231) has the molecular formula C14H17FN2O5S and a molecular weight of 344.36 g/mol. Its IUPAC name is 3-[2-(4-fluorophenoxy)ethyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-(4-fluorophenoxy)ethyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17463231 |
| Molecular Formula | C14H17FN2O5S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 3-[2-(4-fluorophenoxy)ethyl]-5-(2-methylsulfonylethyl)imidazolidine-2,4-dione |
| SMILES | CS(=O)(=O)CCC1NC(=O)N(CCOc2ccc(F)cc2)C1=O |
| InChI | InChI=1S/C14H17FN2O5S/c1-23(20,21)9-6-12-13(18)17(14(19)16-12)7-8-22-11-4-2-10(15)3-5-11/h2-5,12H,6-9H2,1H3,(H,16,19) |
| InChIKey | UWTJLRRKNUVIAH-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|