C15H19N — CID 174632748
2-cyclopenta-1,3-dien-1-yl-3,4,5-trimethyl-1-prop-2-enylpyrrole (PubChem CID 174632748) has the molecular formula C15H19N and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-cyclopenta-1,3-dien-1-yl-3,4,5-trimethyl-1-prop-2-enylpyrrole.
| Compound Name | 2-cyclopenta-1,3-dien-1-yl-3,4,5-trimethyl-1-prop-2-enylpyrrole |
|---|---|
| PubChem CID | 174632748 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-cyclopenta-1,3-dien-1-yl-3,4,5-trimethyl-1-prop-2-enylpyrrole |
| SMILES | C=CCn1c(C)c(C)c(C)c1C1=CC=CC1 |
| InChI | InChI=1S/C15H19N/c1-5-10-16-13(4)11(2)12(3)15(16)14-8-6-7-9-14/h5-8H,1,9-10H2,2-4H3 |
| InChIKey | USXBXFKEXLNYMM-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|