C16H23N3O2S — CID 174633435
[3-[2-(4-methylpiperazin-1-yl)ethyl]-1H-indol-6-yl]methanesulfinic acid (PubChem CID 174633435) has the molecular formula C16H23N3O2S and a molecular weight of 321.45 g/mol. Its IUPAC name is [3-[2-(4-methylpiperazin-1-yl)ethyl]-1H-indol-6-yl]methanesulfinic acid.
| Compound Name | [3-[2-(4-methylpiperazin-1-yl)ethyl]-1H-indol-6-yl]methanesulfinic acid |
|---|---|
| PubChem CID | 174633435 |
| Molecular Formula | C16H23N3O2S |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 321.15 |
| IUPAC Name | [3-[2-(4-methylpiperazin-1-yl)ethyl]-1H-indol-6-yl]methanesulfinic acid |
| SMILES | CN1CCN(CCc2c[nH]c3cc(CS(=O)O)ccc23)CC1 |
| InChI | InChI=1S/C16H23N3O2S/c1-18-6-8-19(9-7-18)5-4-14-11-17-16-10-13(12-22(20)21)2-3-15(14)16/h2-3,10-11,17H,4-9,12H2,1H3,(H,20,21) |
| InChIKey | AOQPXLUSCKDPSY-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 59.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|