About 2-(2-hydroxyethylamino)acetic acid;phosphane
2-(2-hydroxyethylamino)acetic acid;phosphane (PubChem CID 174633538) has the molecular formula C4H12NO3P
and a molecular weight of 153.12 g/mol. Its IUPAC name is 2-(2-hydroxyethylamino)acetic acid;phosphane.
Molecular Properties
| Compound Name | 2-(2-hydroxyethylamino)acetic acid;phosphane |
| PubChem CID | 174633538 |
| Molecular Formula | C4H12NO3P |
| Molecular Weight | 153.12 g/mol |
| Exact Mass | 153.06 |
| IUPAC Name | 2-(2-hydroxyethylamino)acetic acid;phosphane |
| SMILES | O=C(O)CNCCO.P |
| InChI | InChI=1S/C4H9NO3.H3P/c6-2-1-5-3-4(7)8;/h5-6H,1-3H2,(H,7,8);1H3 |
| InChIKey | WUNAMSWYENSLDT-UHFFFAOYSA-N |
| XLogP | -1.29 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.12 |
| LogP ≤ 5 | -1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-hydroxyethylamino)acetic acid;phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-hydroxyethylamino)acetic acid;phosphane?
The IUPAC name of 2-(2-hydroxyethylamino)acetic acid;phosphane (CID 174633538) is 2-(2-hydroxyethylamino)acetic acid;phosphane.
What is the SMILES notation for 2-(2-hydroxyethylamino)acetic acid;phosphane?
The canonical SMILES for 2-(2-hydroxyethylamino)acetic acid;phosphane is O=C(O)CNCCO.P.
What is the InChIKey of 2-(2-hydroxyethylamino)acetic acid;phosphane?
The InChIKey is WUNAMSWYENSLDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO3.H3P/c6-2-1-5-3-4(7)8;/h5-6H,1-3H2,(H,7,8);1H3.
What are the key properties of 2-(2-hydroxyethylamino)acetic acid;phosphane?
2-(2-hydroxyethylamino)acetic acid;phosphane has a molecular weight of 153.12 g/mol, XLogP of -1.29, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-hydroxyethylamino)acetic acid;phosphane is sourced from PubChem (CID 174633538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).