About chloro(methyl)silane;trichloro(methyl)silane
chloro(methyl)silane;trichloro(methyl)silane (PubChem CID 174633557) has the molecular formula C2H8Cl4Si2
and a molecular weight of 230.07 g/mol. Its IUPAC name is chloro(methyl)silane;trichloro(methyl)silane.
Molecular Properties
| Compound Name | chloro(methyl)silane;trichloro(methyl)silane |
| PubChem CID | 174633557 |
| Molecular Formula | C2H8Cl4Si2 |
| Molecular Weight | 230.07 g/mol |
| Exact Mass | 227.89 |
| IUPAC Name | chloro(methyl)silane;trichloro(methyl)silane |
| SMILES | C[SiH2]Cl.C[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/CH3Cl3Si.CH5ClSi/c1-5(2,3)4;1-3-2/h1H3;3H2,1H3 |
| InChIKey | OYIDHSXIFBIJNA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.07 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze chloro(methyl)silane;trichloro(methyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro(methyl)silane;trichloro(methyl)silane?
The IUPAC name of chloro(methyl)silane;trichloro(methyl)silane (CID 174633557) is chloro(methyl)silane;trichloro(methyl)silane.
What is the SMILES notation for chloro(methyl)silane;trichloro(methyl)silane?
The canonical SMILES for chloro(methyl)silane;trichloro(methyl)silane is C[SiH2]Cl.C[Si](Cl)(Cl)Cl.
What is the InChIKey of chloro(methyl)silane;trichloro(methyl)silane?
The InChIKey is OYIDHSXIFBIJNA-UHFFFAOYSA-N. The full InChI is InChI=1S/CH3Cl3Si.CH5ClSi/c1-5(2,3)4;1-3-2/h1H3;3H2,1H3.
What are the key properties of chloro(methyl)silane;trichloro(methyl)silane?
chloro(methyl)silane;trichloro(methyl)silane has a molecular weight of 230.07 g/mol, XLogP of 2.63, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chloro(methyl)silane;trichloro(methyl)silane is sourced from PubChem (CID 174633557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).