About benzaldehyde;propoxy(dipropyl)silane
benzaldehyde;propoxy(dipropyl)silane (PubChem CID 174633887) has the molecular formula C16H28O2Si
and a molecular weight of 280.48 g/mol. Its IUPAC name is benzaldehyde;propoxy(dipropyl)silane.
Molecular Properties
| Compound Name | benzaldehyde;propoxy(dipropyl)silane |
| PubChem CID | 174633887 |
| Molecular Formula | C16H28O2Si |
| Molecular Weight | 280.48 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | benzaldehyde;propoxy(dipropyl)silane |
| SMILES | CCCO[SiH](CCC)CCC.O=Cc1ccccc1 |
| InChI | InChI=1S/C9H22OSi.C7H6O/c1-4-7-10-11(8-5-2)9-6-3;8-6-7-4-2-1-3-5-7/h11H,4-9H2,1-3H3;1-6H |
| InChIKey | GUOYGXOHZREFET-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze benzaldehyde;propoxy(dipropyl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzaldehyde;propoxy(dipropyl)silane?
The IUPAC name of benzaldehyde;propoxy(dipropyl)silane (CID 174633887) is benzaldehyde;propoxy(dipropyl)silane.
What is the SMILES notation for benzaldehyde;propoxy(dipropyl)silane?
The canonical SMILES for benzaldehyde;propoxy(dipropyl)silane is CCCO[SiH](CCC)CCC.O=Cc1ccccc1.
What is the InChIKey of benzaldehyde;propoxy(dipropyl)silane?
The InChIKey is GUOYGXOHZREFET-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22OSi.C7H6O/c1-4-7-10-11(8-5-2)9-6-3;8-6-7-4-2-1-3-5-7/h11H,4-9H2,1-3H3;1-6H.
What are the key properties of benzaldehyde;propoxy(dipropyl)silane?
benzaldehyde;propoxy(dipropyl)silane has a molecular weight of 280.48 g/mol, XLogP of 4.46, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzaldehyde;propoxy(dipropyl)silane is sourced from PubChem (CID 174633887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).