About 2-[[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]amino]acetic acid
2-[[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]amino]acetic acid (PubChem CID 174634306) has the molecular formula C10H17N3O2
and a molecular weight of 211.26 g/mol. Its IUPAC name is 2-[[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]amino]acetic acid |
| PubChem CID | 174634306 |
| Molecular Formula | C10H17N3O2 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.13 |
| IUPAC Name | 2-[[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]amino]acetic acid |
| SMILES | CNC1=CCC(NC)(NCC(=O)O)C=C1 |
| InChI | InChI=1S/C10H17N3O2/c1-11-8-3-5-10(12-2,6-4-8)13-7-9(14)15/h3-5,11-13H,6-7H2,1-2H3,(H,14,15) |
| InChIKey | HBKJKGORQSVNKL-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-[[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]amino]acetic acid?
The IUPAC name of 2-[[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]amino]acetic acid (CID 174634306) is 2-[[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]amino]acetic acid.
What is the SMILES notation for 2-[[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]amino]acetic acid?
The canonical SMILES for 2-[[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]amino]acetic acid is CNC1=CCC(NC)(NCC(=O)O)C=C1.
What is the InChIKey of 2-[[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]amino]acetic acid?
The InChIKey is HBKJKGORQSVNKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O2/c1-11-8-3-5-10(12-2,6-4-8)13-7-9(14)15/h3-5,11-13H,6-7H2,1-2H3,(H,14,15).
What are the key properties of 2-[[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]amino]acetic acid?
2-[[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]amino]acetic acid has a molecular weight of 211.26 g/mol, XLogP of -0.36, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1,4-bis(methylamino)cyclohexa-2,4-dien-1-yl]amino]acetic acid is sourced from PubChem (CID 174634306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).