About 2-[(E)-but-2-enyl]-2-ethyl-1,3-dihydroindene
2-[(E)-but-2-enyl]-2-ethyl-1,3-dihydroindene (PubChem CID 174634333) has the molecular formula C15H20
and a molecular weight of 200.33 g/mol. Its IUPAC name is 2-[(E)-but-2-enyl]-2-ethyl-1,3-dihydroindene.
Molecular Properties
| Compound Name | 2-[(E)-but-2-enyl]-2-ethyl-1,3-dihydroindene |
| PubChem CID | 174634333 |
| Molecular Formula | C15H20 |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | 2-[(E)-but-2-enyl]-2-ethyl-1,3-dihydroindene |
| SMILES | C/C=C/CC1(CC)Cc2ccccc2C1 |
| InChI | InChI=1S/C15H20/c1-3-5-10-15(4-2)11-13-8-6-7-9-14(13)12-15/h3,5-9H,4,10-12H2,1-2H3/b5-3+ |
| InChIKey | KRJHKPWMVIIQLS-HWKANZROSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[(E)-but-2-enyl]-2-ethyl-1,3-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-but-2-enyl]-2-ethyl-1,3-dihydroindene?
The IUPAC name of 2-[(E)-but-2-enyl]-2-ethyl-1,3-dihydroindene (CID 174634333) is 2-[(E)-but-2-enyl]-2-ethyl-1,3-dihydroindene.
What is the SMILES notation for 2-[(E)-but-2-enyl]-2-ethyl-1,3-dihydroindene?
The canonical SMILES for 2-[(E)-but-2-enyl]-2-ethyl-1,3-dihydroindene is C/C=C/CC1(CC)Cc2ccccc2C1.
What is the InChIKey of 2-[(E)-but-2-enyl]-2-ethyl-1,3-dihydroindene?
The InChIKey is KRJHKPWMVIIQLS-HWKANZROSA-N. The full InChI is InChI=1S/C15H20/c1-3-5-10-15(4-2)11-13-8-6-7-9-14(13)12-15/h3,5-9H,4,10-12H2,1-2H3/b5-3+.
What are the key properties of 2-[(E)-but-2-enyl]-2-ethyl-1,3-dihydroindene?
2-[(E)-but-2-enyl]-2-ethyl-1,3-dihydroindene has a molecular weight of 200.33 g/mol, XLogP of 4.15, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-but-2-enyl]-2-ethyl-1,3-dihydroindene is sourced from PubChem (CID 174634333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).