About 1-(3-ethyl-4-imino-5-oxohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea
1-(3-ethyl-4-imino-5-oxohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea (PubChem CID 174634677) has the molecular formula C15H20N6O2
and a molecular weight of 316.37 g/mol. Its IUPAC name is 1-(3-ethyl-4-imino-5-oxohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea.
Molecular Properties
| Compound Name | 1-(3-ethyl-4-imino-5-oxohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea |
| PubChem CID | 174634677 |
| Molecular Formula | C15H20N6O2 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 1-(3-ethyl-4-imino-5-oxohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea |
| SMILES | [H]/N=C(\C(C)=O)C(CC)CCNC(=O)Nc1cnc2[nH]ccc2n1 |
| InChI | InChI=1S/C15H20N6O2/c1-3-10(13(16)9(2)22)4-6-18-15(23)21-12-8-19-14-11(20-12)5-7-17-14/h5,7-8,10,16H,3-4,6H2,1-2H3,(H,17,19)(H2,18,20,21,23)/b16-13+ |
| InChIKey | XUCHJYJSNNFKAS-DTQAZKPQSA-N |
| XLogP | 2.10 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-ethyl-4-imino-5-oxohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-ethyl-4-imino-5-oxohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea?
The IUPAC name of 1-(3-ethyl-4-imino-5-oxohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea (CID 174634677) is 1-(3-ethyl-4-imino-5-oxohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea.
What is the SMILES notation for 1-(3-ethyl-4-imino-5-oxohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea?
The canonical SMILES for 1-(3-ethyl-4-imino-5-oxohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea is [H]/N=C(\C(C)=O)C(CC)CCNC(=O)Nc1cnc2[nH]ccc2n1.
What is the InChIKey of 1-(3-ethyl-4-imino-5-oxohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea?
The InChIKey is XUCHJYJSNNFKAS-DTQAZKPQSA-N. The full InChI is InChI=1S/C15H20N6O2/c1-3-10(13(16)9(2)22)4-6-18-15(23)21-12-8-19-14-11(20-12)5-7-17-14/h5,7-8,10,16H,3-4,6H2,1-2H3,(H,17,19)(H2,18,20,21,23)/b16-13+.
What are the key properties of 1-(3-ethyl-4-imino-5-oxohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea?
1-(3-ethyl-4-imino-5-oxohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea has a molecular weight of 316.37 g/mol, XLogP of 2.10, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-ethyl-4-imino-5-oxohexyl)-3-(5H-pyrrolo[2,3-b]pyrazin-2-yl)urea is sourced from PubChem (CID 174634677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).