About ethyl formate;8-[4-(2-methoxyethoxy)piperidin-1-yl]-1,6-naphthyridine
ethyl formate;8-[4-(2-methoxyethoxy)piperidin-1-yl]-1,6-naphthyridine (PubChem CID 174634840) has the molecular formula C19H27N3O4
and a molecular weight of 361.44 g/mol. Its IUPAC name is ethyl formate;8-[4-(2-methoxyethoxy)piperidin-1-yl]-1,6-naphthyridine.
Molecular Properties
| Compound Name | ethyl formate;8-[4-(2-methoxyethoxy)piperidin-1-yl]-1,6-naphthyridine |
| PubChem CID | 174634840 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | ethyl formate;8-[4-(2-methoxyethoxy)piperidin-1-yl]-1,6-naphthyridine |
| SMILES | CCOC=O.COCCOC1CCN(c2cncc3cccnc23)CC1 |
| InChI | InChI=1S/C16H21N3O2.C3H6O2/c1-20-9-10-21-14-4-7-19(8-5-14)15-12-17-11-13-3-2-6-18-16(13)15;1-2-5-3-4/h2-3,6,11-12,14H,4-5,7-10H2,1H3;3H,2H2,1H3 |
| InChIKey | SVZJUNCWMKETPH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 73.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl formate;8-[4-(2-methoxyethoxy)piperidin-1-yl]-1,6-naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl formate;8-[4-(2-methoxyethoxy)piperidin-1-yl]-1,6-naphthyridine?
The IUPAC name of ethyl formate;8-[4-(2-methoxyethoxy)piperidin-1-yl]-1,6-naphthyridine (CID 174634840) is ethyl formate;8-[4-(2-methoxyethoxy)piperidin-1-yl]-1,6-naphthyridine.
What is the SMILES notation for ethyl formate;8-[4-(2-methoxyethoxy)piperidin-1-yl]-1,6-naphthyridine?
The canonical SMILES for ethyl formate;8-[4-(2-methoxyethoxy)piperidin-1-yl]-1,6-naphthyridine is CCOC=O.COCCOC1CCN(c2cncc3cccnc23)CC1.
What is the InChIKey of ethyl formate;8-[4-(2-methoxyethoxy)piperidin-1-yl]-1,6-naphthyridine?
The InChIKey is SVZJUNCWMKETPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N3O2.C3H6O2/c1-20-9-10-21-14-4-7-19(8-5-14)15-12-17-11-13-3-2-6-18-16(13)15;1-2-5-3-4/h2-3,6,11-12,14H,4-5,7-10H2,1H3;3H,2H2,1H3.
What are the key properties of ethyl formate;8-[4-(2-methoxyethoxy)piperidin-1-yl]-1,6-naphthyridine?
ethyl formate;8-[4-(2-methoxyethoxy)piperidin-1-yl]-1,6-naphthyridine has a molecular weight of 361.44 g/mol, XLogP of 2.44, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl formate;8-[4-(2-methoxyethoxy)piperidin-1-yl]-1,6-naphthyridine is sourced from PubChem (CID 174634840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).