C13H12BrFN4O2 — CID 174636076
(5R)-3-(4-bromo-3-fluorophenyl)-5-(triazol-1-ylmethyl)-1,3-oxazolidine-2-carbaldehyde (PubChem CID 174636076) has the molecular formula C13H12BrFN4O2 and a molecular weight of 355.17 g/mol. Its IUPAC name is (5R)-3-(4-bromo-3-fluorophenyl)-5-(triazol-1-ylmethyl)-1,3-oxazolidine-2-carbaldehyde.
| Compound Name | (5R)-3-(4-bromo-3-fluorophenyl)-5-(triazol-1-ylmethyl)-1,3-oxazolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174636076 |
| Molecular Formula | C13H12BrFN4O2 |
| Molecular Weight | 355.17 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | (5R)-3-(4-bromo-3-fluorophenyl)-5-(triazol-1-ylmethyl)-1,3-oxazolidine-2-carbaldehyde |
| SMILES | O=CC1O[C@@H](Cn2ccnn2)CN1c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C13H12BrFN4O2/c14-11-2-1-9(5-12(11)15)19-7-10(21-13(19)8-20)6-18-4-3-16-17-18/h1-5,8,10,13H,6-7H2/t10-,13?/m0/s1 |
| InChIKey | LBMBRLXUENXWBL-NKUHCKNESA-N |
| XLogP | 1.61 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.17 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|