About hydron;pyrrolo[2,3-b]indole
hydron;pyrrolo[2,3-b]indole (PubChem CID 174636442) has the molecular formula C10H7N2+
and a molecular weight of 155.18 g/mol. Its IUPAC name is hydron;pyrrolo[2,3-b]indole.
Molecular Properties
| Compound Name | hydron;pyrrolo[2,3-b]indole |
| PubChem CID | 174636442 |
| Molecular Formula | C10H7N2+ |
| Molecular Weight | 155.18 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | hydron;pyrrolo[2,3-b]indole |
| SMILES | C1=NC2=Nc3ccccc3C2=C1.[H+] |
| InChI | InChI=1S/C10H6N2/c1-2-4-9-7(3-1)8-5-6-11-10(8)12-9/h1-6H/p+1 |
| InChIKey | UNZGDQIKANZIDF-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.18 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze hydron;pyrrolo[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;pyrrolo[2,3-b]indole?
The IUPAC name of hydron;pyrrolo[2,3-b]indole (CID 174636442) is hydron;pyrrolo[2,3-b]indole.
What is the SMILES notation for hydron;pyrrolo[2,3-b]indole?
The canonical SMILES for hydron;pyrrolo[2,3-b]indole is C1=NC2=Nc3ccccc3C2=C1.[H+].
What is the InChIKey of hydron;pyrrolo[2,3-b]indole?
The InChIKey is UNZGDQIKANZIDF-UHFFFAOYSA-O. The full InChI is InChI=1S/C10H6N2/c1-2-4-9-7(3-1)8-5-6-11-10(8)12-9/h1-6H/p+1.
What are the key properties of hydron;pyrrolo[2,3-b]indole?
hydron;pyrrolo[2,3-b]indole has a molecular weight of 155.18 g/mol, XLogP of 2.31, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;pyrrolo[2,3-b]indole is sourced from PubChem (CID 174636442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).