About 4-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylic acid
4-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylic acid (PubChem CID 174636526) has the molecular formula C13H12FNO5
and a molecular weight of 281.24 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylic acid.
Molecular Properties
| Compound Name | 4-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylic acid |
| PubChem CID | 174636526 |
| Molecular Formula | C13H12FNO5 |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylic acid |
| SMILES | O=C(O)C1CC(Cc2ccc(F)cc2)C(=O)N1C(=O)O |
| InChI | InChI=1S/C13H12FNO5/c14-9-3-1-7(2-4-9)5-8-6-10(12(17)18)15(11(8)16)13(19)20/h1-4,8,10H,5-6H2,(H,17,18)(H,19,20) |
| InChIKey | NTGNBTQUSRJWHL-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 94.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylic acid?
The IUPAC name of 4-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylic acid (CID 174636526) is 4-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylic acid.
What is the SMILES notation for 4-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylic acid?
The canonical SMILES for 4-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylic acid is O=C(O)C1CC(Cc2ccc(F)cc2)C(=O)N1C(=O)O.
What is the InChIKey of 4-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylic acid?
The InChIKey is NTGNBTQUSRJWHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12FNO5/c14-9-3-1-7(2-4-9)5-8-6-10(12(17)18)15(11(8)16)13(19)20/h1-4,8,10H,5-6H2,(H,17,18)(H,19,20).
What are the key properties of 4-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylic acid?
4-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylic acid has a molecular weight of 281.24 g/mol, XLogP of 1.35, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-fluorophenyl)methyl]-5-oxopyrrolidine-1,2-dicarboxylic acid is sourced from PubChem (CID 174636526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).