2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid

C9H14F3NO3 — CID 174636897

IUPAC2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid
SMILESCCCCC(CNC(=O)C(F)(F)F)C(=O)O
InChIInChI=1S/C9H14F3NO3/c1-2-3-4-6(7(14)15)5-13-8(16)9(10,11)12/h6H,2-5H2,1H3,(H,13,16)(H,14,15)
InChIKeyGASLBVRNXBPBPY-UHFFFAOYSA-N
MW241.21 g/mol
LogP1.56
Rot. Bonds6

About 2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid

2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid (PubChem CID 174636897) has the molecular formula C9H14F3NO3 and a molecular weight of 241.21 g/mol. Its IUPAC name is 2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid.

Molecular Properties

Compound Name2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid
PubChem CID174636897
Molecular FormulaC9H14F3NO3
Molecular Weight241.21 g/mol
Exact Mass241.09
IUPAC Name2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid
SMILESCCCCC(CNC(=O)C(F)(F)F)C(=O)O
InChIInChI=1S/C9H14F3NO3/c1-2-3-4-6(7(14)15)5-13-8(16)9(10,11)12/h6H,2-5H2,1H3,(H,13,16)(H,14,15)
InChIKeyGASLBVRNXBPBPY-UHFFFAOYSA-N
XLogP1.56
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.21
LogP ≤ 51.56
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid?
The IUPAC name of 2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid (CID 174636897) is 2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid.
What is the SMILES notation for 2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid?
The canonical SMILES for 2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid is CCCCC(CNC(=O)C(F)(F)F)C(=O)O.
What is the InChIKey of 2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid?
The InChIKey is GASLBVRNXBPBPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO3/c1-2-3-4-6(7(14)15)5-13-8(16)9(10,11)12/h6H,2-5H2,1H3,(H,13,16)(H,14,15).
What are the key properties of 2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid?
2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid has a molecular weight of 241.21 g/mol, XLogP of 1.56, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[(2,2,2-trifluoroacetyl)amino]methyl]hexanoic acid is sourced from PubChem (CID 174636897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).