C8H4F12N2 — CID 174637669
1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3-(trifluoromethyl)-2H-imidazole (PubChem CID 174637669) has the molecular formula C8H4F12N2 and a molecular weight of 356.11 g/mol. Its IUPAC name is 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3-(trifluoromethyl)-2H-imidazole.
| Compound Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3-(trifluoromethyl)-2H-imidazole |
|---|---|
| PubChem CID | 174637669 |
| Molecular Formula | C8H4F12N2 |
| Molecular Weight | 356.11 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 1-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-3-(trifluoromethyl)-2H-imidazole |
| SMILES | FC(F)(F)N1C=CN(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C1 |
| InChI | InChI=1S/C8H4F12N2/c9-4(10,6(13,14)15)5(11,12)7(16,17)21-1-2-22(3-21)8(18,19)20/h1-2H,3H2 |
| InChIKey | GNKWIXWRPPPOLR-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.11 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|