About 2-isocyanatopropyl hexanoate
2-isocyanatopropyl hexanoate (PubChem CID 174637907) has the molecular formula C10H17NO3
and a molecular weight of 199.25 g/mol. Its IUPAC name is 2-isocyanatopropyl hexanoate.
Molecular Properties
| Compound Name | 2-isocyanatopropyl hexanoate |
| PubChem CID | 174637907 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | 2-isocyanatopropyl hexanoate |
| SMILES | CCCCCC(=O)OCC(C)N=C=O |
| InChI | InChI=1S/C10H17NO3/c1-3-4-5-6-10(13)14-7-9(2)11-8-12/h9H,3-7H2,1-2H3 |
| InChIKey | VTRKVCWIVPGQIK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 2-isocyanatopropyl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-isocyanatopropyl hexanoate?
The IUPAC name of 2-isocyanatopropyl hexanoate (CID 174637907) is 2-isocyanatopropyl hexanoate.
What is the SMILES notation for 2-isocyanatopropyl hexanoate?
The canonical SMILES for 2-isocyanatopropyl hexanoate is CCCCCC(=O)OCC(C)N=C=O.
What is the InChIKey of 2-isocyanatopropyl hexanoate?
The InChIKey is VTRKVCWIVPGQIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO3/c1-3-4-5-6-10(13)14-7-9(2)11-8-12/h9H,3-7H2,1-2H3.
What are the key properties of 2-isocyanatopropyl hexanoate?
2-isocyanatopropyl hexanoate has a molecular weight of 199.25 g/mol, XLogP of 1.83, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-isocyanatopropyl hexanoate is sourced from PubChem (CID 174637907), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).