C26H25N — CID 174637933
1-(3,9-dimethyl-2,3,4,5-tetrahydrochrysen-1-yl)azepine (PubChem CID 174637933) has the molecular formula C26H25N and a molecular weight of 351.49 g/mol. Its IUPAC name is 1-(3,9-dimethyl-2,3,4,5-tetrahydrochrysen-1-yl)azepine.
| Compound Name | 1-(3,9-dimethyl-2,3,4,5-tetrahydrochrysen-1-yl)azepine |
|---|---|
| PubChem CID | 174637933 |
| Molecular Formula | C26H25N |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | 1-(3,9-dimethyl-2,3,4,5-tetrahydrochrysen-1-yl)azepine |
| SMILES | Cc1ccc2c(c1)=c1ccc3c(c1CC=2)CC(C)CC=3N1C=CC=CC=C1 |
| InChI | InChI=1S/C26H25N/c1-18-7-8-20-9-10-22-21(24(20)15-18)11-12-23-25(22)16-19(2)17-26(23)27-13-5-3-4-6-14-27/h3-9,11-15,19H,10,16-17H2,1-2H3 |
| InChIKey | NYBFPUQOVDAVLH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |