C11H11N3O — CID 17463875
(5E)-5-benzylidene-3-methyl-1,2-dihydro-1,2,4-triazin-6-one (PubChem CID 17463875) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is (5E)-5-benzylidene-3-methyl-1,2-dihydro-1,2,4-triazin-6-one.
| Compound Name | (5E)-5-benzylidene-3-methyl-1,2-dihydro-1,2,4-triazin-6-one |
|---|---|
| PubChem CID | 17463875 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | (5E)-5-benzylidene-3-methyl-1,2-dihydro-1,2,4-triazin-6-one |
| SMILES | CC1=N/C(=C/c2ccccc2)C(=O)NN1 |
| InChI | InChI=1S/C11H11N3O/c1-8-12-10(11(15)14-13-8)7-9-5-3-2-4-6-9/h2-7H,1H3,(H,12,13)(H,14,15)/b10-7+ |
| InChIKey | FPCPJKZXAWCFOB-JXMROGBWSA-N |
| XLogP | 1.08 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|