About europium(2+);bis(2H-pyridin-2-ide)
europium(2+);bis(2H-pyridin-2-ide) (PubChem CID 174639173) has the molecular formula C10H8EuN2
and a molecular weight of 308.15 g/mol. Its IUPAC name is europium(2+);bis(2H-pyridin-2-ide).
Molecular Properties
| Compound Name | europium(2+);bis(2H-pyridin-2-ide) |
| PubChem CID | 174639173 |
| Molecular Formula | C10H8EuN2 |
| Molecular Weight | 308.15 g/mol |
| Exact Mass | 308.99 |
| IUPAC Name | europium(2+);bis(2H-pyridin-2-ide) |
| SMILES | [Eu+2].[c-]1ccccn1.[c-]1ccccn1 |
| InChI | InChI=1S/2C5H4N.Eu/c2*1-2-4-6-5-3-1;/h2*1-4H;/q2*-1;+2 |
| InChIKey | GVOGOZBIYPJKPK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.15 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze europium(2+);bis(2H-pyridin-2-ide) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of europium(2+);bis(2H-pyridin-2-ide)?
The IUPAC name of europium(2+);bis(2H-pyridin-2-ide) (CID 174639173) is europium(2+);bis(2H-pyridin-2-ide).
What is the SMILES notation for europium(2+);bis(2H-pyridin-2-ide)?
The canonical SMILES for europium(2+);bis(2H-pyridin-2-ide) is [Eu+2].[c-]1ccccn1.[c-]1ccccn1.
What is the InChIKey of europium(2+);bis(2H-pyridin-2-ide)?
The InChIKey is GVOGOZBIYPJKPK-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H4N.Eu/c2*1-2-4-6-5-3-1;/h2*1-4H;/q2*-1;+2.
What are the key properties of europium(2+);bis(2H-pyridin-2-ide)?
europium(2+);bis(2H-pyridin-2-ide) has a molecular weight of 308.15 g/mol, XLogP of 1.76, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for europium(2+);bis(2H-pyridin-2-ide) is sourced from PubChem (CID 174639173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).