About 2-ethyl-3-hydroxy-3,7-dihydro-2H-oxepin-4-one
2-ethyl-3-hydroxy-3,7-dihydro-2H-oxepin-4-one (PubChem CID 174640599) has the molecular formula C8H12O3
and a molecular weight of 156.18 g/mol. Its IUPAC name is 2-ethyl-3-hydroxy-3,7-dihydro-2H-oxepin-4-one.
Molecular Properties
| Compound Name | 2-ethyl-3-hydroxy-3,7-dihydro-2H-oxepin-4-one |
| PubChem CID | 174640599 |
| Molecular Formula | C8H12O3 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.08 |
| IUPAC Name | 2-ethyl-3-hydroxy-3,7-dihydro-2H-oxepin-4-one |
| SMILES | CCC1OCC=CC(=O)C1O |
| InChI | InChI=1S/C8H12O3/c1-2-7-8(10)6(9)4-3-5-11-7/h3-4,7-8,10H,2,5H2,1H3 |
| InChIKey | AXEKLPOHSKKSFI-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-ethyl-3-hydroxy-3,7-dihydro-2H-oxepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3-hydroxy-3,7-dihydro-2H-oxepin-4-one?
The IUPAC name of 2-ethyl-3-hydroxy-3,7-dihydro-2H-oxepin-4-one (CID 174640599) is 2-ethyl-3-hydroxy-3,7-dihydro-2H-oxepin-4-one.
What is the SMILES notation for 2-ethyl-3-hydroxy-3,7-dihydro-2H-oxepin-4-one?
The canonical SMILES for 2-ethyl-3-hydroxy-3,7-dihydro-2H-oxepin-4-one is CCC1OCC=CC(=O)C1O.
What is the InChIKey of 2-ethyl-3-hydroxy-3,7-dihydro-2H-oxepin-4-one?
The InChIKey is AXEKLPOHSKKSFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O3/c1-2-7-8(10)6(9)4-3-5-11-7/h3-4,7-8,10H,2,5H2,1H3.
What are the key properties of 2-ethyl-3-hydroxy-3,7-dihydro-2H-oxepin-4-one?
2-ethyl-3-hydroxy-3,7-dihydro-2H-oxepin-4-one has a molecular weight of 156.18 g/mol, XLogP of 0.28, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3-hydroxy-3,7-dihydro-2H-oxepin-4-one is sourced from PubChem (CID 174640599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).