About 4-ethylsulfonylphenol;morpholine
4-ethylsulfonylphenol;morpholine (PubChem CID 174641127) has the molecular formula C12H19NO4S
and a molecular weight of 273.35 g/mol. Its IUPAC name is 4-ethylsulfonylphenol;morpholine.
Molecular Properties
| Compound Name | 4-ethylsulfonylphenol;morpholine |
| PubChem CID | 174641127 |
| Molecular Formula | C12H19NO4S |
| Molecular Weight | 273.35 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 4-ethylsulfonylphenol;morpholine |
| SMILES | C1COCCN1.CCS(=O)(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C8H10O3S.C4H9NO/c1-2-12(10,11)8-5-3-7(9)4-6-8;1-3-6-4-2-5-1/h3-6,9H,2H2,1H3;5H,1-4H2 |
| InChIKey | CYAKDKJHMUENBU-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.35 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-ethylsulfonylphenol;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylsulfonylphenol;morpholine?
The IUPAC name of 4-ethylsulfonylphenol;morpholine (CID 174641127) is 4-ethylsulfonylphenol;morpholine.
What is the SMILES notation for 4-ethylsulfonylphenol;morpholine?
The canonical SMILES for 4-ethylsulfonylphenol;morpholine is C1COCCN1.CCS(=O)(=O)c1ccc(O)cc1.
What is the InChIKey of 4-ethylsulfonylphenol;morpholine?
The InChIKey is CYAKDKJHMUENBU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O3S.C4H9NO/c1-2-12(10,11)8-5-3-7(9)4-6-8;1-3-6-4-2-5-1/h3-6,9H,2H2,1H3;5H,1-4H2.
What are the key properties of 4-ethylsulfonylphenol;morpholine?
4-ethylsulfonylphenol;morpholine has a molecular weight of 273.35 g/mol, XLogP of 0.79, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylsulfonylphenol;morpholine is sourced from PubChem (CID 174641127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).