C8H16N2O — CID 174641204
4-(methoxymethyl)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole (PubChem CID 174641204) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 4-(methoxymethyl)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 4-(methoxymethyl)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 174641204 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 4-(methoxymethyl)-1,2,3,3a,4,5,6,6a-octahydropyrrolo[3,4-c]pyrrole |
| SMILES | COCC1NCC2CNCC21 |
| InChI | InChI=1S/C8H16N2O/c1-11-5-8-7-4-9-2-6(7)3-10-8/h6-10H,2-5H2,1H3 |
| InChIKey | XIFXDKIRKIWBRQ-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |