About 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-(2-pyrrol-1-ylphenyl)propan-2-one
1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-(2-pyrrol-1-ylphenyl)propan-2-one (PubChem CID 174641291) has the molecular formula C20H17N3O
and a molecular weight of 315.38 g/mol. Its IUPAC name is 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-(2-pyrrol-1-ylphenyl)propan-2-one.
Molecular Properties
| Compound Name | 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-(2-pyrrol-1-ylphenyl)propan-2-one |
| PubChem CID | 174641291 |
| Molecular Formula | C20H17N3O |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-(2-pyrrol-1-ylphenyl)propan-2-one |
| SMILES | O=C(Cc1ccccc1-n1cccc1)Cc1ccnc2[nH]ccc12 |
| InChI | InChI=1S/C20H17N3O/c24-17(13-15-7-9-21-20-18(15)8-10-22-20)14-16-5-1-2-6-19(16)23-11-3-4-12-23/h1-12H,13-14H2,(H,21,22) |
| InChIKey | URDDEHOBIMXVLW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-(2-pyrrol-1-ylphenyl)propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-(2-pyrrol-1-ylphenyl)propan-2-one?
The IUPAC name of 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-(2-pyrrol-1-ylphenyl)propan-2-one (CID 174641291) is 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-(2-pyrrol-1-ylphenyl)propan-2-one.
What is the SMILES notation for 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-(2-pyrrol-1-ylphenyl)propan-2-one?
The canonical SMILES for 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-(2-pyrrol-1-ylphenyl)propan-2-one is O=C(Cc1ccccc1-n1cccc1)Cc1ccnc2[nH]ccc12.
What is the InChIKey of 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-(2-pyrrol-1-ylphenyl)propan-2-one?
The InChIKey is URDDEHOBIMXVLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O/c24-17(13-15-7-9-21-20-18(15)8-10-22-20)14-16-5-1-2-6-19(16)23-11-3-4-12-23/h1-12H,13-14H2,(H,21,22).
What are the key properties of 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-(2-pyrrol-1-ylphenyl)propan-2-one?
1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-(2-pyrrol-1-ylphenyl)propan-2-one has a molecular weight of 315.38 g/mol, XLogP of 3.71, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-pyrrolo[2,3-b]pyridin-4-yl)-3-(2-pyrrol-1-ylphenyl)propan-2-one is sourced from PubChem (CID 174641291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).