About 3,4-dinitro-3,4-dihydropyridine
3,4-dinitro-3,4-dihydropyridine (PubChem CID 174641611) has the molecular formula C5H5N3O4
and a molecular weight of 171.11 g/mol. Its IUPAC name is 3,4-dinitro-3,4-dihydropyridine.
Molecular Properties
| Compound Name | 3,4-dinitro-3,4-dihydropyridine |
| PubChem CID | 174641611 |
| Molecular Formula | C5H5N3O4 |
| Molecular Weight | 171.11 g/mol |
| Exact Mass | 171.03 |
| IUPAC Name | 3,4-dinitro-3,4-dihydropyridine |
| SMILES | O=[N+]([O-])C1C=CN=CC1[N+](=O)[O-] |
| InChI | InChI=1S/C5H5N3O4/c9-7(10)4-1-2-6-3-5(4)8(11)12/h1-5H |
| InChIKey | WCJAQQSRLRVRHR-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 98.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.11 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dinitro-3,4-dihydropyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dinitro-3,4-dihydropyridine?
The IUPAC name of 3,4-dinitro-3,4-dihydropyridine (CID 174641611) is 3,4-dinitro-3,4-dihydropyridine.
What is the SMILES notation for 3,4-dinitro-3,4-dihydropyridine?
The canonical SMILES for 3,4-dinitro-3,4-dihydropyridine is O=[N+]([O-])C1C=CN=CC1[N+](=O)[O-].
What is the InChIKey of 3,4-dinitro-3,4-dihydropyridine?
The InChIKey is WCJAQQSRLRVRHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5N3O4/c9-7(10)4-1-2-6-3-5(4)8(11)12/h1-5H.
What are the key properties of 3,4-dinitro-3,4-dihydropyridine?
3,4-dinitro-3,4-dihydropyridine has a molecular weight of 171.11 g/mol, XLogP of -0.12, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dinitro-3,4-dihydropyridine is sourced from PubChem (CID 174641611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).