C19H18N6O — CID 174641874
3-(1,3-benzoxazol-2-yl)-5-[1-(4-iminobutan-2-yl)pyrazol-4-yl]pyridin-2-amine (PubChem CID 174641874) has the molecular formula C19H18N6O and a molecular weight of 346.39 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-5-[1-(4-iminobutan-2-yl)pyrazol-4-yl]pyridin-2-amine.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-5-[1-(4-iminobutan-2-yl)pyrazol-4-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 174641874 |
| Molecular Formula | C19H18N6O |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-5-[1-(4-iminobutan-2-yl)pyrazol-4-yl]pyridin-2-amine |
| SMILES | [H]/N=C/CC(C)n1cc(-c2cnc(N)c(-c3nc4ccccc4o3)c2)cn1 |
| InChI | InChI=1S/C19H18N6O/c1-12(6-7-20)25-11-14(10-23-25)13-8-15(18(21)22-9-13)19-24-16-4-2-3-5-17(16)26-19/h2-5,7-12,20H,6H2,1H3,(H2,21,22)/b20-7+ |
| InChIKey | WQYRWNJGWHUDOW-IFRROFPPSA-N |
| XLogP | 3.94 |
| TPSA | 106.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|