C16H26N2O3 — CID 174641884
2-[4-(ethylaminomethyl)phenyl]propanoic acid;morpholine (PubChem CID 174641884) has the molecular formula C16H26N2O3 and a molecular weight of 294.40 g/mol. Its IUPAC name is 2-[4-(ethylaminomethyl)phenyl]propanoic acid;morpholine.
| Compound Name | 2-[4-(ethylaminomethyl)phenyl]propanoic acid;morpholine |
|---|---|
| PubChem CID | 174641884 |
| Molecular Formula | C16H26N2O3 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | 2-[4-(ethylaminomethyl)phenyl]propanoic acid;morpholine |
| SMILES | C1COCCN1.CCNCc1ccc(C(C)C(=O)O)cc1 |
| InChI | InChI=1S/C12H17NO2.C4H9NO/c1-3-13-8-10-4-6-11(7-5-10)9(2)12(14)15;1-3-6-4-2-5-1/h4-7,9,13H,3,8H2,1-2H3,(H,14,15);5H,1-4H2 |
| InChIKey | RMIUEBJUJOBQEL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |