C24H19FN4O3 — CID 174641915
4-fluoro-N-[3-[1-[(8-formylquinazolin-4-yl)amino]ethyl]phenyl]-3-hydroxybenzamide (PubChem CID 174641915) has the molecular formula C24H19FN4O3 and a molecular weight of 430.44 g/mol. Its IUPAC name is 4-fluoro-N-[3-[1-[(8-formylquinazolin-4-yl)amino]ethyl]phenyl]-3-hydroxybenzamide.
| Compound Name | 4-fluoro-N-[3-[1-[(8-formylquinazolin-4-yl)amino]ethyl]phenyl]-3-hydroxybenzamide |
|---|---|
| PubChem CID | 174641915 |
| Molecular Formula | C24H19FN4O3 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 4-fluoro-N-[3-[1-[(8-formylquinazolin-4-yl)amino]ethyl]phenyl]-3-hydroxybenzamide |
| SMILES | CC(Nc1ncnc2c(C=O)cccc12)c1cccc(NC(=O)c2ccc(F)c(O)c2)c1 |
| InChI | InChI=1S/C24H19FN4O3/c1-14(28-23-19-7-3-5-17(12-30)22(19)26-13-27-23)15-4-2-6-18(10-15)29-24(32)16-8-9-20(25)21(31)11-16/h2-14,31H,1H3,(H,29,32)(H,26,27,28) |
| InChIKey | NWWBGMFDCDWKPA-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|