C24H21FN4O2 — CID 174641925
2-fluoro-4-methoxy-N-[3-[(1R)-1-(quinazolin-4-ylamino)ethyl]phenyl]benzamide (PubChem CID 174641925) has the molecular formula C24H21FN4O2 and a molecular weight of 416.46 g/mol. Its IUPAC name is 2-fluoro-4-methoxy-N-[3-[(1R)-1-(quinazolin-4-ylamino)ethyl]phenyl]benzamide.
| Compound Name | 2-fluoro-4-methoxy-N-[3-[(1R)-1-(quinazolin-4-ylamino)ethyl]phenyl]benzamide |
|---|---|
| PubChem CID | 174641925 |
| Molecular Formula | C24H21FN4O2 |
| Molecular Weight | 416.46 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-fluoro-4-methoxy-N-[3-[(1R)-1-(quinazolin-4-ylamino)ethyl]phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc([C@@H](C)Nc3ncnc4ccccc34)c2)c(F)c1 |
| InChI | InChI=1S/C24H21FN4O2/c1-15(28-23-20-8-3-4-9-22(20)26-14-27-23)16-6-5-7-17(12-16)29-24(30)19-11-10-18(31-2)13-21(19)25/h3-15H,1-2H3,(H,29,30)(H,26,27,28)/t15-/m1/s1 |
| InChIKey | BIEQWSLGYBYVGP-OAHLLOKOSA-N |
| XLogP | 5.20 |
| TPSA | 76.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.46 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |