About cyclopropane;4-(trifluoromethyl)-1H-pyrimidin-6-one
cyclopropane;4-(trifluoromethyl)-1H-pyrimidin-6-one (PubChem CID 174641979) has the molecular formula C8H9F3N2O
and a molecular weight of 206.17 g/mol. Its IUPAC name is cyclopropane;4-(trifluoromethyl)-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | cyclopropane;4-(trifluoromethyl)-1H-pyrimidin-6-one |
| PubChem CID | 174641979 |
| Molecular Formula | C8H9F3N2O |
| Molecular Weight | 206.17 g/mol |
| Exact Mass | 206.07 |
| IUPAC Name | cyclopropane;4-(trifluoromethyl)-1H-pyrimidin-6-one |
| SMILES | C1CC1.O=c1cc(C(F)(F)F)nc[nH]1 |
| InChI | InChI=1S/C5H3F3N2O.C3H6/c6-5(7,8)3-1-4(11)10-2-9-3;1-2-3-1/h1-2H,(H,9,10,11);1-3H2 |
| InChIKey | HGOQMPHQQBQOLE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclopropane;4-(trifluoromethyl)-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropane;4-(trifluoromethyl)-1H-pyrimidin-6-one?
The IUPAC name of cyclopropane;4-(trifluoromethyl)-1H-pyrimidin-6-one (CID 174641979) is cyclopropane;4-(trifluoromethyl)-1H-pyrimidin-6-one.
What is the SMILES notation for cyclopropane;4-(trifluoromethyl)-1H-pyrimidin-6-one?
The canonical SMILES for cyclopropane;4-(trifluoromethyl)-1H-pyrimidin-6-one is C1CC1.O=c1cc(C(F)(F)F)nc[nH]1.
What is the InChIKey of cyclopropane;4-(trifluoromethyl)-1H-pyrimidin-6-one?
The InChIKey is HGOQMPHQQBQOLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3F3N2O.C3H6/c6-5(7,8)3-1-4(11)10-2-9-3;1-2-3-1/h1-2H,(H,9,10,11);1-3H2.
What are the key properties of cyclopropane;4-(trifluoromethyl)-1H-pyrimidin-6-one?
cyclopropane;4-(trifluoromethyl)-1H-pyrimidin-6-one has a molecular weight of 206.17 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropane;4-(trifluoromethyl)-1H-pyrimidin-6-one is sourced from PubChem (CID 174641979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).