C22H28F4N4O4S — CID 174642040
[1-amino-1-[4-[1-[[1-cyclohexyl-3-(trifluoromethyl)pyrazol-5-yl]methylamino]-1-oxopropan-2-yl]-2-fluorophenyl]ethyl] hydrogen sulfite (PubChem CID 174642040) has the molecular formula C22H28F4N4O4S and a molecular weight of 520.55 g/mol. Its IUPAC name is [1-amino-1-[4-[1-[[1-cyclohexyl-3-(trifluoromethyl)pyrazol-5-yl]methylamino]-1-oxopropan-2-yl]-2-fluorophenyl]ethyl] hydrogen sulfite.
| Compound Name | [1-amino-1-[4-[1-[[1-cyclohexyl-3-(trifluoromethyl)pyrazol-5-yl]methylamino]-1-oxopropan-2-yl]-2-fluorophenyl]ethyl] hydrogen sulfite |
|---|---|
| PubChem CID | 174642040 |
| Molecular Formula | C22H28F4N4O4S |
| Molecular Weight | 520.55 g/mol |
| Exact Mass | 520.18 |
| IUPAC Name | [1-amino-1-[4-[1-[[1-cyclohexyl-3-(trifluoromethyl)pyrazol-5-yl]methylamino]-1-oxopropan-2-yl]-2-fluorophenyl]ethyl] hydrogen sulfite |
| SMILES | CC(C(=O)NCc1cc(C(F)(F)F)nn1C1CCCCC1)c1ccc(C(C)(N)OS(=O)O)c(F)c1 |
| InChI | InChI=1S/C22H28F4N4O4S/c1-13(14-8-9-17(18(23)10-14)21(2,27)34-35(32)33)20(31)28-12-16-11-19(22(24,25)26)29-30(16)15-6-4-3-5-7-15/h8-11,13,15H,3-7,12,27H2,1-2H3,(H,28,31)(H,32,33) |
| InChIKey | LNHDPEHRIKCTCA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 119.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|