C17H31Br2Cl2N4O6P — CID 174642593
(2S,4S)-N,N-bis(2-chloroethyl)-4-hydroperoxy-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;3-bromo-1-[4-(3-bromopropanoyl)piperazin-1-yl]propan-1-one (PubChem CID 174642593) has the molecular formula C17H31Br2Cl2N4O6P and a molecular weight of 649.14 g/mol. Its IUPAC name is (2S,4S)-N,N-bis(2-chloroethyl)-4-hydroperoxy-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;3-bromo-1-[4-(3-bromopropanoyl)piperazin-1-yl]propan-1-one.
| Compound Name | (2S,4S)-N,N-bis(2-chloroethyl)-4-hydroperoxy-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;3-bromo-1-[4-(3-bromopropanoyl)piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 174642593 |
| Molecular Formula | C17H31Br2Cl2N4O6P |
| Molecular Weight | 649.14 g/mol |
| Exact Mass | 645.97 |
| IUPAC Name | (2S,4S)-N,N-bis(2-chloroethyl)-4-hydroperoxy-2-oxo-1,3,2λ5-oxazaphosphinan-2-amine;3-bromo-1-[4-(3-bromopropanoyl)piperazin-1-yl]propan-1-one |
| SMILES | O=C(CCBr)N1CCN(C(=O)CCBr)CC1.O=[P@@]1(N(CCCl)CCCl)N[C@@H](OO)CCO1 |
| InChI | InChI=1S/C10H16Br2N2O2.C7H15Cl2N2O4P/c11-3-1-9(15)13-5-7-14(8-6-13)10(16)2-4-12;8-2-4-11(5-3-9)16(13)10-7(15-12)1-6-14-16/h1-8H2;7,12H,1-6H2,(H,10,13)/t;7-,16-/m.0/s1 |
| InChIKey | JCLLKPSEANALGG-WVNUNRFWSA-N |
| XLogP | 2.93 |
| TPSA | 111.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.14 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|