About N',N'-di(propan-2-yl)ethane-1,2-diamine;prop-2-enamide
N',N'-di(propan-2-yl)ethane-1,2-diamine;prop-2-enamide (PubChem CID 174642702) has the molecular formula C11H25N3O
and a molecular weight of 215.34 g/mol. Its IUPAC name is N',N'-di(propan-2-yl)ethane-1,2-diamine;prop-2-enamide.
Molecular Properties
| Compound Name | N',N'-di(propan-2-yl)ethane-1,2-diamine;prop-2-enamide |
| PubChem CID | 174642702 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | N',N'-di(propan-2-yl)ethane-1,2-diamine;prop-2-enamide |
| SMILES | C=CC(N)=O.CC(C)N(CCN)C(C)C |
| InChI | InChI=1S/C8H20N2.C3H5NO/c1-7(2)10(6-5-9)8(3)4;1-2-3(4)5/h7-8H,5-6,9H2,1-4H3;2H,1H2,(H2,4,5) |
| InChIKey | HWFZQASAXMTMGS-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 72.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N',N'-di(propan-2-yl)ethane-1,2-diamine;prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-di(propan-2-yl)ethane-1,2-diamine;prop-2-enamide?
The IUPAC name of N',N'-di(propan-2-yl)ethane-1,2-diamine;prop-2-enamide (CID 174642702) is N',N'-di(propan-2-yl)ethane-1,2-diamine;prop-2-enamide.
What is the SMILES notation for N',N'-di(propan-2-yl)ethane-1,2-diamine;prop-2-enamide?
The canonical SMILES for N',N'-di(propan-2-yl)ethane-1,2-diamine;prop-2-enamide is C=CC(N)=O.CC(C)N(CCN)C(C)C.
What is the InChIKey of N',N'-di(propan-2-yl)ethane-1,2-diamine;prop-2-enamide?
The InChIKey is HWFZQASAXMTMGS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2.C3H5NO/c1-7(2)10(6-5-9)8(3)4;1-2-3(4)5/h7-8H,5-6,9H2,1-4H3;2H,1H2,(H2,4,5).
What are the key properties of N',N'-di(propan-2-yl)ethane-1,2-diamine;prop-2-enamide?
N',N'-di(propan-2-yl)ethane-1,2-diamine;prop-2-enamide has a molecular weight of 215.34 g/mol, XLogP of 0.72, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-di(propan-2-yl)ethane-1,2-diamine;prop-2-enamide is sourced from PubChem (CID 174642702), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).