About 2,6-dimethyl-5-sulfanylcyclohexa-2,4-dien-1-one
2,6-dimethyl-5-sulfanylcyclohexa-2,4-dien-1-one (PubChem CID 174642720) has the molecular formula C8H10OS
and a molecular weight of 154.23 g/mol. Its IUPAC name is 2,6-dimethyl-5-sulfanylcyclohexa-2,4-dien-1-one.
Molecular Properties
| Compound Name | 2,6-dimethyl-5-sulfanylcyclohexa-2,4-dien-1-one |
| PubChem CID | 174642720 |
| Molecular Formula | C8H10OS |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.05 |
| IUPAC Name | 2,6-dimethyl-5-sulfanylcyclohexa-2,4-dien-1-one |
| SMILES | CC1=CC=C(S)C(C)C1=O |
| InChI | InChI=1S/C8H10OS/c1-5-3-4-7(10)6(2)8(5)9/h3-4,6,10H,1-2H3 |
| InChIKey | VZVGCWZTFNCZSX-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethyl-5-sulfanylcyclohexa-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethyl-5-sulfanylcyclohexa-2,4-dien-1-one?
The IUPAC name of 2,6-dimethyl-5-sulfanylcyclohexa-2,4-dien-1-one (CID 174642720) is 2,6-dimethyl-5-sulfanylcyclohexa-2,4-dien-1-one.
What is the SMILES notation for 2,6-dimethyl-5-sulfanylcyclohexa-2,4-dien-1-one?
The canonical SMILES for 2,6-dimethyl-5-sulfanylcyclohexa-2,4-dien-1-one is CC1=CC=C(S)C(C)C1=O.
What is the InChIKey of 2,6-dimethyl-5-sulfanylcyclohexa-2,4-dien-1-one?
The InChIKey is VZVGCWZTFNCZSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10OS/c1-5-3-4-7(10)6(2)8(5)9/h3-4,6,10H,1-2H3.
What are the key properties of 2,6-dimethyl-5-sulfanylcyclohexa-2,4-dien-1-one?
2,6-dimethyl-5-sulfanylcyclohexa-2,4-dien-1-one has a molecular weight of 154.23 g/mol, XLogP of 1.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethyl-5-sulfanylcyclohexa-2,4-dien-1-one is sourced from PubChem (CID 174642720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).