C18H13BF5NO3 — CID 174643927
(2,3,4,5,6-pentafluorophenoxy)-phenylmethoxyborinic acid;pyridine (PubChem CID 174643927) has the molecular formula C18H13BF5NO3 and a molecular weight of 397.11 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenoxy)-phenylmethoxyborinic acid;pyridine.
| Compound Name | (2,3,4,5,6-pentafluorophenoxy)-phenylmethoxyborinic acid;pyridine |
|---|---|
| PubChem CID | 174643927 |
| Molecular Formula | C18H13BF5NO3 |
| Molecular Weight | 397.11 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenoxy)-phenylmethoxyborinic acid;pyridine |
| SMILES | OB(OCc1ccccc1)Oc1c(F)c(F)c(F)c(F)c1F.c1ccncc1 |
| InChI | InChI=1S/C13H8BF5O3.C5H5N/c15-8-9(16)11(18)13(12(19)10(8)17)22-14(20)21-6-7-4-2-1-3-5-7;1-2-4-6-5-3-1/h1-5,20H,6H2;1-5H |
| InChIKey | XFYBDNZLDJNPKN-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.11 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|