About (8-ethynyl-5-fluoro-3,4,6-trimethylquinolin-2-yl)methanol
(8-ethynyl-5-fluoro-3,4,6-trimethylquinolin-2-yl)methanol (PubChem CID 174644830) has the molecular formula C15H14FNO
and a molecular weight of 243.28 g/mol. Its IUPAC name is (8-ethynyl-5-fluoro-3,4,6-trimethylquinolin-2-yl)methanol.
Molecular Properties
| Compound Name | (8-ethynyl-5-fluoro-3,4,6-trimethylquinolin-2-yl)methanol |
| PubChem CID | 174644830 |
| Molecular Formula | C15H14FNO |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.11 |
| IUPAC Name | (8-ethynyl-5-fluoro-3,4,6-trimethylquinolin-2-yl)methanol |
| SMILES | C#Cc1cc(C)c(F)c2c(C)c(C)c(CO)nc12 |
| InChI | InChI=1S/C15H14FNO/c1-5-11-6-8(2)14(16)13-10(4)9(3)12(7-18)17-15(11)13/h1,6,18H,7H2,2-4H3 |
| InChIKey | HXWBFRYNASUCGG-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (8-ethynyl-5-fluoro-3,4,6-trimethylquinolin-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8-ethynyl-5-fluoro-3,4,6-trimethylquinolin-2-yl)methanol?
The IUPAC name of (8-ethynyl-5-fluoro-3,4,6-trimethylquinolin-2-yl)methanol (CID 174644830) is (8-ethynyl-5-fluoro-3,4,6-trimethylquinolin-2-yl)methanol.
What is the SMILES notation for (8-ethynyl-5-fluoro-3,4,6-trimethylquinolin-2-yl)methanol?
The canonical SMILES for (8-ethynyl-5-fluoro-3,4,6-trimethylquinolin-2-yl)methanol is C#Cc1cc(C)c(F)c2c(C)c(C)c(CO)nc12.
What is the InChIKey of (8-ethynyl-5-fluoro-3,4,6-trimethylquinolin-2-yl)methanol?
The InChIKey is HXWBFRYNASUCGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14FNO/c1-5-11-6-8(2)14(16)13-10(4)9(3)12(7-18)17-15(11)13/h1,6,18H,7H2,2-4H3.
What are the key properties of (8-ethynyl-5-fluoro-3,4,6-trimethylquinolin-2-yl)methanol?
(8-ethynyl-5-fluoro-3,4,6-trimethylquinolin-2-yl)methanol has a molecular weight of 243.28 g/mol, XLogP of 2.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (8-ethynyl-5-fluoro-3,4,6-trimethylquinolin-2-yl)methanol is sourced from PubChem (CID 174644830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).