C15H20F3NO3 — CID 174644977
acetic acid;2-[[4-(trifluoromethoxy)phenyl]methyl]piperidine (PubChem CID 174644977) has the molecular formula C15H20F3NO3 and a molecular weight of 319.32 g/mol. Its IUPAC name is acetic acid;2-[[4-(trifluoromethoxy)phenyl]methyl]piperidine.
| Compound Name | acetic acid;2-[[4-(trifluoromethoxy)phenyl]methyl]piperidine |
|---|---|
| PubChem CID | 174644977 |
| Molecular Formula | C15H20F3NO3 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | acetic acid;2-[[4-(trifluoromethoxy)phenyl]methyl]piperidine |
| SMILES | CC(=O)O.FC(F)(F)Oc1ccc(CC2CCCCN2)cc1 |
| InChI | InChI=1S/C13H16F3NO.C2H4O2/c14-13(15,16)18-12-6-4-10(5-7-12)9-11-3-1-2-8-17-11;1-2(3)4/h4-7,11,17H,1-3,8-9H2;1H3,(H,3,4) |
| InChIKey | UMWLBEQQVVTDKV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |