About 1,6-dimethyl-4-nitro-2,3-dihydropyridine-4-carboxylic acid
1,6-dimethyl-4-nitro-2,3-dihydropyridine-4-carboxylic acid (PubChem CID 174645217) has the molecular formula C8H12N2O4
and a molecular weight of 200.19 g/mol. Its IUPAC name is 1,6-dimethyl-4-nitro-2,3-dihydropyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1,6-dimethyl-4-nitro-2,3-dihydropyridine-4-carboxylic acid |
| PubChem CID | 174645217 |
| Molecular Formula | C8H12N2O4 |
| Molecular Weight | 200.19 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | 1,6-dimethyl-4-nitro-2,3-dihydropyridine-4-carboxylic acid |
| SMILES | CC1=CC(C(=O)O)([N+](=O)[O-])CCN1C |
| InChI | InChI=1S/C8H12N2O4/c1-6-5-8(7(11)12,10(13)14)3-4-9(6)2/h5H,3-4H2,1-2H3,(H,11,12) |
| InChIKey | SCMJAIVCABPILQ-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 83.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,6-dimethyl-4-nitro-2,3-dihydropyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dimethyl-4-nitro-2,3-dihydropyridine-4-carboxylic acid?
The IUPAC name of 1,6-dimethyl-4-nitro-2,3-dihydropyridine-4-carboxylic acid (CID 174645217) is 1,6-dimethyl-4-nitro-2,3-dihydropyridine-4-carboxylic acid.
What is the SMILES notation for 1,6-dimethyl-4-nitro-2,3-dihydropyridine-4-carboxylic acid?
The canonical SMILES for 1,6-dimethyl-4-nitro-2,3-dihydropyridine-4-carboxylic acid is CC1=CC(C(=O)O)([N+](=O)[O-])CCN1C.
What is the InChIKey of 1,6-dimethyl-4-nitro-2,3-dihydropyridine-4-carboxylic acid?
The InChIKey is SCMJAIVCABPILQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4/c1-6-5-8(7(11)12,10(13)14)3-4-9(6)2/h5H,3-4H2,1-2H3,(H,11,12).
What are the key properties of 1,6-dimethyl-4-nitro-2,3-dihydropyridine-4-carboxylic acid?
1,6-dimethyl-4-nitro-2,3-dihydropyridine-4-carboxylic acid has a molecular weight of 200.19 g/mol, XLogP of 0.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dimethyl-4-nitro-2,3-dihydropyridine-4-carboxylic acid is sourced from PubChem (CID 174645217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).