About 1-cyclopentyl-4-methyl-6,6a-dihydro-5H-chrysen-4-ol
1-cyclopentyl-4-methyl-6,6a-dihydro-5H-chrysen-4-ol (PubChem CID 174646887) has the molecular formula C24H26O
and a molecular weight of 330.47 g/mol. Its IUPAC name is 1-cyclopentyl-4-methyl-6,6a-dihydro-5H-chrysen-4-ol.
Molecular Properties
| Compound Name | 1-cyclopentyl-4-methyl-6,6a-dihydro-5H-chrysen-4-ol |
| PubChem CID | 174646887 |
| Molecular Formula | C24H26O |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.20 |
| IUPAC Name | 1-cyclopentyl-4-methyl-6,6a-dihydro-5H-chrysen-4-ol |
| SMILES | CC1(O)C=CC(C2CCCC2)=c2ccc3c(c21)CCC1C=CC=CC=31 |
| InChI | InChI=1S/C24H26O/c1-24(25)15-14-19(16-6-2-3-7-16)21-13-12-20-18-9-5-4-8-17(18)10-11-22(20)23(21)24/h4-5,8-9,12-17,25H,2-3,6-7,10-11H2,1H3 |
| InChIKey | ZPZDQMOKXHUZQR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclopentyl-4-methyl-6,6a-dihydro-5H-chrysen-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopentyl-4-methyl-6,6a-dihydro-5H-chrysen-4-ol?
The IUPAC name of 1-cyclopentyl-4-methyl-6,6a-dihydro-5H-chrysen-4-ol (CID 174646887) is 1-cyclopentyl-4-methyl-6,6a-dihydro-5H-chrysen-4-ol.
What is the SMILES notation for 1-cyclopentyl-4-methyl-6,6a-dihydro-5H-chrysen-4-ol?
The canonical SMILES for 1-cyclopentyl-4-methyl-6,6a-dihydro-5H-chrysen-4-ol is CC1(O)C=CC(C2CCCC2)=c2ccc3c(c21)CCC1C=CC=CC=31.
What is the InChIKey of 1-cyclopentyl-4-methyl-6,6a-dihydro-5H-chrysen-4-ol?
The InChIKey is ZPZDQMOKXHUZQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26O/c1-24(25)15-14-19(16-6-2-3-7-16)21-13-12-20-18-9-5-4-8-17(18)10-11-22(20)23(21)24/h4-5,8-9,12-17,25H,2-3,6-7,10-11H2,1H3.
What are the key properties of 1-cyclopentyl-4-methyl-6,6a-dihydro-5H-chrysen-4-ol?
1-cyclopentyl-4-methyl-6,6a-dihydro-5H-chrysen-4-ol has a molecular weight of 330.47 g/mol, XLogP of 3.64, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopentyl-4-methyl-6,6a-dihydro-5H-chrysen-4-ol is sourced from PubChem (CID 174646887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).