About 1-O-amino 3-O-tert-butyl (2R)-2-[2-(6-chloro-5-fluoro-1H-indol-3-yl)ethyl]propanedioate
1-O-amino 3-O-tert-butyl (2R)-2-[2-(6-chloro-5-fluoro-1H-indol-3-yl)ethyl]propanedioate (PubChem CID 174647046) has the molecular formula C17H20ClFN2O4
and a molecular weight of 370.81 g/mol. Its IUPAC name is 1-O-amino 3-O-tert-butyl (2R)-2-[2-(6-chloro-5-fluoro-1H-indol-3-yl)ethyl]propanedioate.
Molecular Properties
| Compound Name | 1-O-amino 3-O-tert-butyl (2R)-2-[2-(6-chloro-5-fluoro-1H-indol-3-yl)ethyl]propanedioate |
| PubChem CID | 174647046 |
| Molecular Formula | C17H20ClFN2O4 |
| Molecular Weight | 370.81 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | 1-O-amino 3-O-tert-butyl (2R)-2-[2-(6-chloro-5-fluoro-1H-indol-3-yl)ethyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)[C@@H](CCc1c[nH]c2cc(Cl)c(F)cc12)C(=O)ON |
| InChI | InChI=1S/C17H20ClFN2O4/c1-17(2,3)24-15(22)10(16(23)25-20)5-4-9-8-21-14-7-12(18)13(19)6-11(9)14/h6-8,10,21H,4-5,20H2,1-3H3/t10-/m1/s1 |
| InChIKey | HKMCHOFYQAGNKG-SNVBAGLBSA-N |
| XLogP | 3.27 |
| TPSA | 94.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.81 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-O-amino 3-O-tert-butyl (2R)-2-[2-(6-chloro-5-fluoro-1H-indol-3-yl)ethyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-amino 3-O-tert-butyl (2R)-2-[2-(6-chloro-5-fluoro-1H-indol-3-yl)ethyl]propanedioate?
The IUPAC name of 1-O-amino 3-O-tert-butyl (2R)-2-[2-(6-chloro-5-fluoro-1H-indol-3-yl)ethyl]propanedioate (CID 174647046) is 1-O-amino 3-O-tert-butyl (2R)-2-[2-(6-chloro-5-fluoro-1H-indol-3-yl)ethyl]propanedioate.
What is the SMILES notation for 1-O-amino 3-O-tert-butyl (2R)-2-[2-(6-chloro-5-fluoro-1H-indol-3-yl)ethyl]propanedioate?
The canonical SMILES for 1-O-amino 3-O-tert-butyl (2R)-2-[2-(6-chloro-5-fluoro-1H-indol-3-yl)ethyl]propanedioate is CC(C)(C)OC(=O)[C@@H](CCc1c[nH]c2cc(Cl)c(F)cc12)C(=O)ON.
What is the InChIKey of 1-O-amino 3-O-tert-butyl (2R)-2-[2-(6-chloro-5-fluoro-1H-indol-3-yl)ethyl]propanedioate?
The InChIKey is HKMCHOFYQAGNKG-SNVBAGLBSA-N. The full InChI is InChI=1S/C17H20ClFN2O4/c1-17(2,3)24-15(22)10(16(23)25-20)5-4-9-8-21-14-7-12(18)13(19)6-11(9)14/h6-8,10,21H,4-5,20H2,1-3H3/t10-/m1/s1.
What are the key properties of 1-O-amino 3-O-tert-butyl (2R)-2-[2-(6-chloro-5-fluoro-1H-indol-3-yl)ethyl]propanedioate?
1-O-amino 3-O-tert-butyl (2R)-2-[2-(6-chloro-5-fluoro-1H-indol-3-yl)ethyl]propanedioate has a molecular weight of 370.81 g/mol, XLogP of 3.27, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-amino 3-O-tert-butyl (2R)-2-[2-(6-chloro-5-fluoro-1H-indol-3-yl)ethyl]propanedioate is sourced from PubChem (CID 174647046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).