About N'-hydroxy-N-iodo-N'-phenylbutanediamide
N'-hydroxy-N-iodo-N'-phenylbutanediamide (PubChem CID 174647089) has the molecular formula C10H11IN2O3
and a molecular weight of 334.11 g/mol. Its IUPAC name is N'-hydroxy-N-iodo-N'-phenylbutanediamide.
Molecular Properties
| Compound Name | N'-hydroxy-N-iodo-N'-phenylbutanediamide |
| PubChem CID | 174647089 |
| Molecular Formula | C10H11IN2O3 |
| Molecular Weight | 334.11 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | N'-hydroxy-N-iodo-N'-phenylbutanediamide |
| SMILES | O=C(CCC(=O)N(O)c1ccccc1)NI |
| InChI | InChI=1S/C10H11IN2O3/c11-12-9(14)6-7-10(15)13(16)8-4-2-1-3-5-8/h1-5,16H,6-7H2,(H,12,14) |
| InChIKey | UJFDUTYPSWHENQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.11 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-hydroxy-N-iodo-N'-phenylbutanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-hydroxy-N-iodo-N'-phenylbutanediamide?
The IUPAC name of N'-hydroxy-N-iodo-N'-phenylbutanediamide (CID 174647089) is N'-hydroxy-N-iodo-N'-phenylbutanediamide.
What is the SMILES notation for N'-hydroxy-N-iodo-N'-phenylbutanediamide?
The canonical SMILES for N'-hydroxy-N-iodo-N'-phenylbutanediamide is O=C(CCC(=O)N(O)c1ccccc1)NI.
What is the InChIKey of N'-hydroxy-N-iodo-N'-phenylbutanediamide?
The InChIKey is UJFDUTYPSWHENQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11IN2O3/c11-12-9(14)6-7-10(15)13(16)8-4-2-1-3-5-8/h1-5,16H,6-7H2,(H,12,14).
What are the key properties of N'-hydroxy-N-iodo-N'-phenylbutanediamide?
N'-hydroxy-N-iodo-N'-phenylbutanediamide has a molecular weight of 334.11 g/mol, XLogP of 1.66, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-hydroxy-N-iodo-N'-phenylbutanediamide is sourced from PubChem (CID 174647089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).