C18H18FN5S2 — CID 17464732
3-[[cyclopropyl(pyridin-3-ylmethyl)amino]methyl]-5-(2-fluoroanilino)-1,3,4-thiadiazole-2-thione (PubChem CID 17464732) has the molecular formula C18H18FN5S2 and a molecular weight of 387.51 g/mol. Its IUPAC name is 3-[[cyclopropyl(pyridin-3-ylmethyl)amino]methyl]-5-(2-fluoroanilino)-1,3,4-thiadiazole-2-thione.
| Compound Name | 3-[[cyclopropyl(pyridin-3-ylmethyl)amino]methyl]-5-(2-fluoroanilino)-1,3,4-thiadiazole-2-thione |
|---|---|
| PubChem CID | 17464732 |
| Molecular Formula | C18H18FN5S2 |
| Molecular Weight | 387.51 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 3-[[cyclopropyl(pyridin-3-ylmethyl)amino]methyl]-5-(2-fluoroanilino)-1,3,4-thiadiazole-2-thione |
| SMILES | Fc1ccccc1Nc1nn(CN(Cc2cccnc2)C2CC2)c(=S)s1 |
| InChI | InChI=1S/C18H18FN5S2/c19-15-5-1-2-6-16(15)21-17-22-24(18(25)26-17)12-23(14-7-8-14)11-13-4-3-9-20-10-13/h1-6,9-10,14H,7-8,11-12H2,(H,21,22) |
| InChIKey | TWLHIYCTKJMQMN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.51 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|