About N',N'-diethyl-3-hydroxy-3-pyridin-4-ylpropanehydrazide;dihydrochloride
N',N'-diethyl-3-hydroxy-3-pyridin-4-ylpropanehydrazide;dihydrochloride (PubChem CID 174647612) has the molecular formula C12H21Cl2N3O2
and a molecular weight of 310.22 g/mol. Its IUPAC name is N',N'-diethyl-3-hydroxy-3-pyridin-4-ylpropanehydrazide;dihydrochloride.
Molecular Properties
| Compound Name | N',N'-diethyl-3-hydroxy-3-pyridin-4-ylpropanehydrazide;dihydrochloride |
| PubChem CID | 174647612 |
| Molecular Formula | C12H21Cl2N3O2 |
| Molecular Weight | 310.22 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N',N'-diethyl-3-hydroxy-3-pyridin-4-ylpropanehydrazide;dihydrochloride |
| SMILES | CCN(CC)NC(=O)CC(O)c1ccncc1.Cl.Cl |
| InChI | InChI=1S/C12H19N3O2.2ClH/c1-3-15(4-2)14-12(17)9-11(16)10-5-7-13-8-6-10;;/h5-8,11,16H,3-4,9H2,1-2H3,(H,14,17);2*1H |
| InChIKey | XIRGTMCBPROEAN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N',N'-diethyl-3-hydroxy-3-pyridin-4-ylpropanehydrazide;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N',N'-diethyl-3-hydroxy-3-pyridin-4-ylpropanehydrazide;dihydrochloride?
The IUPAC name of N',N'-diethyl-3-hydroxy-3-pyridin-4-ylpropanehydrazide;dihydrochloride (CID 174647612) is N',N'-diethyl-3-hydroxy-3-pyridin-4-ylpropanehydrazide;dihydrochloride.
What is the SMILES notation for N',N'-diethyl-3-hydroxy-3-pyridin-4-ylpropanehydrazide;dihydrochloride?
The canonical SMILES for N',N'-diethyl-3-hydroxy-3-pyridin-4-ylpropanehydrazide;dihydrochloride is CCN(CC)NC(=O)CC(O)c1ccncc1.Cl.Cl.
What is the InChIKey of N',N'-diethyl-3-hydroxy-3-pyridin-4-ylpropanehydrazide;dihydrochloride?
The InChIKey is XIRGTMCBPROEAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2.2ClH/c1-3-15(4-2)14-12(17)9-11(16)10-5-7-13-8-6-10;;/h5-8,11,16H,3-4,9H2,1-2H3,(H,14,17);2*1H.
What are the key properties of N',N'-diethyl-3-hydroxy-3-pyridin-4-ylpropanehydrazide;dihydrochloride?
N',N'-diethyl-3-hydroxy-3-pyridin-4-ylpropanehydrazide;dihydrochloride has a molecular weight of 310.22 g/mol, XLogP of 1.72, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N',N'-diethyl-3-hydroxy-3-pyridin-4-ylpropanehydrazide;dihydrochloride is sourced from PubChem (CID 174647612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).