C17H16F3N3O5S4 — CID 174647670
amino 4-[(2S)-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethylsulfonylamino)ethyl]benzenesulfonate (PubChem CID 174647670) has the molecular formula C17H16F3N3O5S4 and a molecular weight of 527.59 g/mol. Its IUPAC name is amino 4-[(2S)-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethylsulfonylamino)ethyl]benzenesulfonate.
| Compound Name | amino 4-[(2S)-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethylsulfonylamino)ethyl]benzenesulfonate |
|---|---|
| PubChem CID | 174647670 |
| Molecular Formula | C17H16F3N3O5S4 |
| Molecular Weight | 527.59 g/mol |
| Exact Mass | 526.99 |
| IUPAC Name | amino 4-[(2S)-2-(2-thiophen-2-yl-1,3-thiazol-4-yl)-2-(2,2,2-trifluoroethylsulfonylamino)ethyl]benzenesulfonate |
| SMILES | NOS(=O)(=O)c1ccc(C[C@H](NS(=O)(=O)CC(F)(F)F)c2csc(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C17H16F3N3O5S4/c18-17(19,20)10-31(24,25)23-13(14-9-30-16(22-14)15-2-1-7-29-15)8-11-3-5-12(6-4-11)32(26,27)28-21/h1-7,9,13,23H,8,10,21H2/t13-/m0/s1 |
| InChIKey | FUCQOBHDUXENRJ-ZDUSSCGKSA-N |
| XLogP | 3.22 |
| TPSA | 128.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.59 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|