C30H39Cl4N11O2 — CID 174647774
2-[6-[[amino-[[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine;2-chloroacetamide;4-chlorophenol (PubChem CID 174647774) has the molecular formula C30H39Cl4N11O2 and a molecular weight of 727.53 g/mol. Its IUPAC name is 2-[6-[[amino-[[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine;2-chloroacetamide;4-chlorophenol.
| Compound Name | 2-[6-[[amino-[[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine;2-chloroacetamide;4-chlorophenol |
|---|---|
| PubChem CID | 174647774 |
| Molecular Formula | C30H39Cl4N11O2 |
| Molecular Weight | 727.53 g/mol |
| Exact Mass | 725.20 |
| IUPAC Name | 2-[6-[[amino-[[amino-(4-chloroanilino)methylidene]amino]methylidene]amino]hexyl]-1-[amino-(4-chloroanilino)methylidene]guanidine;2-chloroacetamide;4-chlorophenol |
| SMILES | NC(=N/C(N)=N/CCCCCC/N=C(\N)N=C(N)Nc1ccc(Cl)cc1)Nc1ccc(Cl)cc1.NC(=O)CCl.Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H30Cl2N10.C6H5ClO.C2H4ClNO/c23-15-5-9-17(10-6-15)31-21(27)33-19(25)29-13-3-1-2-4-14-30-20(26)34-22(28)32-18-11-7-16(24)8-12-18;7-5-1-3-6(8)4-2-5;3-1-2(4)5/h5-12H,1-4,13-14H2,(H5,25,27,29,31,33)(H5,26,28,30,32,34);1-4,8H;1H2,(H2,4,5) |
| InChIKey | ANPCFEHHGNCUAJ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 240.90 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|