About (2-chloro-4-nitrophenyl) nitrite
(2-chloro-4-nitrophenyl) nitrite (PubChem CID 174647913) has the molecular formula C6H3ClN2O4
and a molecular weight of 202.55 g/mol. Its IUPAC name is (2-chloro-4-nitrophenyl) nitrite.
Molecular Properties
| Compound Name | (2-chloro-4-nitrophenyl) nitrite |
| PubChem CID | 174647913 |
| Molecular Formula | C6H3ClN2O4 |
| Molecular Weight | 202.55 g/mol |
| Exact Mass | 201.98 |
| IUPAC Name | (2-chloro-4-nitrophenyl) nitrite |
| SMILES | O=NOc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C6H3ClN2O4/c7-5-3-4(9(11)12)1-2-6(5)13-8-10/h1-3H |
| InChIKey | GLPBAGNURHQJSR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 81.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.55 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-chloro-4-nitrophenyl) nitrite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-chloro-4-nitrophenyl) nitrite?
The IUPAC name of (2-chloro-4-nitrophenyl) nitrite (CID 174647913) is (2-chloro-4-nitrophenyl) nitrite.
What is the SMILES notation for (2-chloro-4-nitrophenyl) nitrite?
The canonical SMILES for (2-chloro-4-nitrophenyl) nitrite is O=NOc1ccc([N+](=O)[O-])cc1Cl.
What is the InChIKey of (2-chloro-4-nitrophenyl) nitrite?
The InChIKey is GLPBAGNURHQJSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3ClN2O4/c7-5-3-4(9(11)12)1-2-6(5)13-8-10/h1-3H.
What are the key properties of (2-chloro-4-nitrophenyl) nitrite?
(2-chloro-4-nitrophenyl) nitrite has a molecular weight of 202.55 g/mol, XLogP of 2.31, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-chloro-4-nitrophenyl) nitrite is sourced from PubChem (CID 174647913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).