C10H13F3N2 — CID 174648172
N-[(2,4,6-trifluoro-4-methylcyclohexa-2,5-dien-1-ylidene)amino]propan-2-amine (PubChem CID 174648172) has the molecular formula C10H13F3N2 and a molecular weight of 218.22 g/mol. Its IUPAC name is N-[(2,4,6-trifluoro-4-methylcyclohexa-2,5-dien-1-ylidene)amino]propan-2-amine.
| Compound Name | N-[(2,4,6-trifluoro-4-methylcyclohexa-2,5-dien-1-ylidene)amino]propan-2-amine |
|---|---|
| PubChem CID | 174648172 |
| Molecular Formula | C10H13F3N2 |
| Molecular Weight | 218.22 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | N-[(2,4,6-trifluoro-4-methylcyclohexa-2,5-dien-1-ylidene)amino]propan-2-amine |
| SMILES | CC(C)NN=C1C(F)=CC(C)(F)C=C1F |
| InChI | InChI=1S/C10H13F3N2/c1-6(2)14-15-9-7(11)4-10(3,13)5-8(9)12/h4-6,14H,1-3H3/b15-9- |
| InChIKey | VTZSXOGXZWYKMH-DHDCSXOGSA-N |
| XLogP | 2.79 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.22 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|