C23H30N4O — CID 17464843
1,3-bis[4-(pyrrolidin-1-ylmethyl)phenyl]urea (PubChem CID 17464843) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is 1,3-bis[4-(pyrrolidin-1-ylmethyl)phenyl]urea.
| Compound Name | 1,3-bis[4-(pyrrolidin-1-ylmethyl)phenyl]urea |
|---|---|
| PubChem CID | 17464843 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | 1,3-bis[4-(pyrrolidin-1-ylmethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc(CN2CCCC2)cc1)Nc1ccc(CN2CCCC2)cc1 |
| InChI | InChI=1S/C23H30N4O/c28-23(24-21-9-5-19(6-10-21)17-26-13-1-2-14-26)25-22-11-7-20(8-12-22)18-27-15-3-4-16-27/h5-12H,1-4,13-18H2,(H2,24,25,28) |
| InChIKey | BMXPYXNWLKNTIP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |