About hexafluoroantimony(1-);hydron;triphenyl(3-phenylprop-2-enyl)phosphanium
hexafluoroantimony(1-);hydron;triphenyl(3-phenylprop-2-enyl)phosphanium (PubChem CID 174648580) has the molecular formula C27H25F6PSb+
and a molecular weight of 616.22 g/mol. Its IUPAC name is hexafluoroantimony(1-);hydron;triphenyl(3-phenylprop-2-enyl)phosphanium.
Molecular Properties
| Compound Name | hexafluoroantimony(1-);hydron;triphenyl(3-phenylprop-2-enyl)phosphanium |
| PubChem CID | 174648580 |
| Molecular Formula | C27H25F6PSb+ |
| Molecular Weight | 616.22 g/mol |
| Exact Mass | 615.06 |
| IUPAC Name | hexafluoroantimony(1-);hydron;triphenyl(3-phenylprop-2-enyl)phosphanium |
| SMILES | C(=Cc1ccccc1)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.F[Sb-](F)(F)(F)(F)F.[H+] |
| InChI | InChI=1S/C27H24P.6FH.Sb/c1-5-14-24(15-6-1)16-13-23-28(25-17-7-2-8-18-25,26-19-9-3-10-20-26)27-21-11-4-12-22-27;;;;;;;/h1-22H,23H2;6*1H;/q+1;;;;;;;+5/p-5 |
| InChIKey | GHEMBGNFXIWCHT-UHFFFAOYSA-I |
| XLogP | 7.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 616.22 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze hexafluoroantimony(1-);hydron;triphenyl(3-phenylprop-2-enyl)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexafluoroantimony(1-);hydron;triphenyl(3-phenylprop-2-enyl)phosphanium?
The IUPAC name of hexafluoroantimony(1-);hydron;triphenyl(3-phenylprop-2-enyl)phosphanium (CID 174648580) is hexafluoroantimony(1-);hydron;triphenyl(3-phenylprop-2-enyl)phosphanium.
What is the SMILES notation for hexafluoroantimony(1-);hydron;triphenyl(3-phenylprop-2-enyl)phosphanium?
The canonical SMILES for hexafluoroantimony(1-);hydron;triphenyl(3-phenylprop-2-enyl)phosphanium is C(=Cc1ccccc1)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.F[Sb-](F)(F)(F)(F)F.[H+].
What is the InChIKey of hexafluoroantimony(1-);hydron;triphenyl(3-phenylprop-2-enyl)phosphanium?
The InChIKey is GHEMBGNFXIWCHT-UHFFFAOYSA-I. The full InChI is InChI=1S/C27H24P.6FH.Sb/c1-5-14-24(15-6-1)16-13-23-28(25-17-7-2-8-18-25,26-19-9-3-10-20-26)27-21-11-4-12-22-27;;;;;;;/h1-22H,23H2;6*1H;/q+1;;;;;;;+5/p-5.
What are the key properties of hexafluoroantimony(1-);hydron;triphenyl(3-phenylprop-2-enyl)phosphanium?
hexafluoroantimony(1-);hydron;triphenyl(3-phenylprop-2-enyl)phosphanium has a molecular weight of 616.22 g/mol, XLogP of 7.95, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for hexafluoroantimony(1-);hydron;triphenyl(3-phenylprop-2-enyl)phosphanium is sourced from PubChem (CID 174648580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).